C22H24N2O4 — CID 55413527
2-[[2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]acetyl]amino]-N-prop-2-enylbenzamide (PubChem CID 55413527) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is 2-[[2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]acetyl]amino]-N-prop-2-enylbenzamide.
| Compound Name | 2-[[2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]acetyl]amino]-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 55413527 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 2-[[2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]acetyl]amino]-N-prop-2-enylbenzamide |
| SMILES | C=CCNC(=O)c1ccccc1NC(=O)COc1cccc2c1OC(C)(C)C2 |
| InChI | InChI=1S/C22H24N2O4/c1-4-12-23-21(26)16-9-5-6-10-17(16)24-19(25)14-27-18-11-7-8-15-13-22(2,3)28-20(15)18/h4-11H,1,12-14H2,2-3H3,(H,23,26)(H,24,25) |
| InChIKey | LRXGHSFVKHAHIT-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|