C19H26N4O2 — CID 120586999
4-amino-N-(3-cyclopentyl-1-phenylpyrazol-5-yl)-3-methoxybutanamide (PubChem CID 120586999) has the molecular formula C19H26N4O2 and a molecular weight of 342.44 g/mol. Its IUPAC name is 4-amino-N-(3-cyclopentyl-1-phenylpyrazol-5-yl)-3-methoxybutanamide.
| Compound Name | 4-amino-N-(3-cyclopentyl-1-phenylpyrazol-5-yl)-3-methoxybutanamide |
|---|---|
| PubChem CID | 120586999 |
| Molecular Formula | C19H26N4O2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | 4-amino-N-(3-cyclopentyl-1-phenylpyrazol-5-yl)-3-methoxybutanamide |
| SMILES | COC(CN)CC(=O)Nc1cc(C2CCCC2)nn1-c1ccccc1 |
| InChI | InChI=1S/C19H26N4O2/c1-25-16(13-20)11-19(24)21-18-12-17(14-7-5-6-8-14)22-23(18)15-9-3-2-4-10-15/h2-4,9-10,12,14,16H,5-8,11,13,20H2,1H3,(H,21,24) |
| InChIKey | UQSRYCUOYCFUQR-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |