C22H25N5O3 — CID 56520964
N-(3-cyclopentyl-1-phenylpyrazol-5-yl)-2-(6,8-dioxo-5,7-diazaspiro[3.4]octan-7-yl)acetamide (PubChem CID 56520964) has the molecular formula C22H25N5O3 and a molecular weight of 407.47 g/mol. Its IUPAC name is N-(3-cyclopentyl-1-phenylpyrazol-5-yl)-2-(6,8-dioxo-5,7-diazaspiro[3.4]octan-7-yl)acetamide.
| Compound Name | N-(3-cyclopentyl-1-phenylpyrazol-5-yl)-2-(6,8-dioxo-5,7-diazaspiro[3.4]octan-7-yl)acetamide |
|---|---|
| PubChem CID | 56520964 |
| Molecular Formula | C22H25N5O3 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | N-(3-cyclopentyl-1-phenylpyrazol-5-yl)-2-(6,8-dioxo-5,7-diazaspiro[3.4]octan-7-yl)acetamide |
| SMILES | O=C(CN1C(=O)NC2(CCC2)C1=O)Nc1cc(C2CCCC2)nn1-c1ccccc1 |
| InChI | InChI=1S/C22H25N5O3/c28-19(14-26-20(29)22(11-6-12-22)24-21(26)30)23-18-13-17(15-7-4-5-8-15)25-27(18)16-9-2-1-3-10-16/h1-3,9-10,13,15H,4-8,11-12,14H2,(H,23,28)(H,24,30) |
| InChIKey | CJTITKWBPSBJHP-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|