C24H31N5O3 — CID 38852167
N-(3-tert-butyl-1-phenylpyrazol-5-yl)-2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)acetamide (PubChem CID 38852167) has the molecular formula C24H31N5O3 and a molecular weight of 437.54 g/mol. Its IUPAC name is N-(3-tert-butyl-1-phenylpyrazol-5-yl)-2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)acetamide.
| Compound Name | N-(3-tert-butyl-1-phenylpyrazol-5-yl)-2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)acetamide |
|---|---|
| PubChem CID | 38852167 |
| Molecular Formula | C24H31N5O3 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.24 |
| IUPAC Name | N-(3-tert-butyl-1-phenylpyrazol-5-yl)-2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)acetamide |
| SMILES | CC(C)(C)c1cc(NC(=O)CN2C(=O)NC3(CCCCCC3)C2=O)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C24H31N5O3/c1-23(2,3)18-15-19(29(27-18)17-11-7-6-8-12-17)25-20(30)16-28-21(31)24(26-22(28)32)13-9-4-5-10-14-24/h6-8,11-12,15H,4-5,9-10,13-14,16H2,1-3H3,(H,25,30)(H,26,32) |
| InChIKey | QFPYIUYXUIDACE-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|