C25H29N5O3 — CID 37376049
N-(3-cyclopentyl-1-phenylpyrazol-5-yl)-2-[4-(furan-2-carbonyl)piperazin-1-yl]acetamide (PubChem CID 37376049) has the molecular formula C25H29N5O3 and a molecular weight of 447.54 g/mol. Its IUPAC name is N-(3-cyclopentyl-1-phenylpyrazol-5-yl)-2-[4-(furan-2-carbonyl)piperazin-1-yl]acetamide.
| Compound Name | N-(3-cyclopentyl-1-phenylpyrazol-5-yl)-2-[4-(furan-2-carbonyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 37376049 |
| Molecular Formula | C25H29N5O3 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | N-(3-cyclopentyl-1-phenylpyrazol-5-yl)-2-[4-(furan-2-carbonyl)piperazin-1-yl]acetamide |
| SMILES | O=C(CN1CCN(C(=O)c2ccco2)CC1)Nc1cc(C2CCCC2)nn1-c1ccccc1 |
| InChI | InChI=1S/C25H29N5O3/c31-24(18-28-12-14-29(15-13-28)25(32)22-11-6-16-33-22)26-23-17-21(19-7-4-5-8-19)27-30(23)20-9-2-1-3-10-20/h1-3,6,9-11,16-17,19H,4-5,7-8,12-15,18H2,(H,26,31) |
| InChIKey | WBQVXGQKTJMFIH-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 83.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |