C18H27N3O4 — CID 120588432
4-amino-1-[4-(2-ethoxybenzoyl)piperazin-1-yl]-3-methoxybutan-1-one (PubChem CID 120588432) has the molecular formula C18H27N3O4 and a molecular weight of 349.43 g/mol. Its IUPAC name is 4-amino-1-[4-(2-ethoxybenzoyl)piperazin-1-yl]-3-methoxybutan-1-one.
| Compound Name | 4-amino-1-[4-(2-ethoxybenzoyl)piperazin-1-yl]-3-methoxybutan-1-one |
|---|---|
| PubChem CID | 120588432 |
| Molecular Formula | C18H27N3O4 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | 4-amino-1-[4-(2-ethoxybenzoyl)piperazin-1-yl]-3-methoxybutan-1-one |
| SMILES | CCOc1ccccc1C(=O)N1CCN(C(=O)CC(CN)OC)CC1 |
| InChI | InChI=1S/C18H27N3O4/c1-3-25-16-7-5-4-6-15(16)18(23)21-10-8-20(9-11-21)17(22)12-14(13-19)24-2/h4-7,14H,3,8-13,19H2,1-2H3 |
| InChIKey | QWEJDPIULXXZIX-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 85.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |