C24H28F2N2O5 — CID 55548555
1-[4-[2-(difluoromethoxy)benzoyl]piperazin-1-yl]-4-(2-ethoxyphenoxy)butan-1-one (PubChem CID 55548555) has the molecular formula C24H28F2N2O5 and a molecular weight of 462.49 g/mol. Its IUPAC name is 1-[4-[2-(difluoromethoxy)benzoyl]piperazin-1-yl]-4-(2-ethoxyphenoxy)butan-1-one.
| Compound Name | 1-[4-[2-(difluoromethoxy)benzoyl]piperazin-1-yl]-4-(2-ethoxyphenoxy)butan-1-one |
|---|---|
| PubChem CID | 55548555 |
| Molecular Formula | C24H28F2N2O5 |
| Molecular Weight | 462.49 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | 1-[4-[2-(difluoromethoxy)benzoyl]piperazin-1-yl]-4-(2-ethoxyphenoxy)butan-1-one |
| SMILES | CCOc1ccccc1OCCCC(=O)N1CCN(C(=O)c2ccccc2OC(F)F)CC1 |
| InChI | InChI=1S/C24H28F2N2O5/c1-2-31-20-10-5-6-11-21(20)32-17-7-12-22(29)27-13-15-28(16-14-27)23(30)18-8-3-4-9-19(18)33-24(25)26/h3-6,8-11,24H,2,7,12-17H2,1H3 |
| InChIKey | KPTPDRWBWVADBF-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.49 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|