C15H19N3O2S — CID 120590818
4-amino-3-methoxy-N-[4-(4-methyl-1,3-thiazol-2-yl)phenyl]butanamide (PubChem CID 120590818) has the molecular formula C15H19N3O2S and a molecular weight of 305.40 g/mol. Its IUPAC name is 4-amino-3-methoxy-N-[4-(4-methyl-1,3-thiazol-2-yl)phenyl]butanamide.
| Compound Name | 4-amino-3-methoxy-N-[4-(4-methyl-1,3-thiazol-2-yl)phenyl]butanamide |
|---|---|
| PubChem CID | 120590818 |
| Molecular Formula | C15H19N3O2S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 4-amino-3-methoxy-N-[4-(4-methyl-1,3-thiazol-2-yl)phenyl]butanamide |
| SMILES | COC(CN)CC(=O)Nc1ccc(-c2nc(C)cs2)cc1 |
| InChI | InChI=1S/C15H19N3O2S/c1-10-9-21-15(17-10)11-3-5-12(6-4-11)18-14(19)7-13(8-16)20-2/h3-6,9,13H,7-8,16H2,1-2H3,(H,18,19) |
| InChIKey | OPULCYPIGLFJAP-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |