C16H24ClN3O3S — CID 120590833
4-amino-3-methoxy-N-[3-(thiomorpholine-4-carbonyl)phenyl]butanamide;hydrochloride (PubChem CID 120590833) has the molecular formula C16H24ClN3O3S and a molecular weight of 373.91 g/mol. Its IUPAC name is 4-amino-3-methoxy-N-[3-(thiomorpholine-4-carbonyl)phenyl]butanamide;hydrochloride.
| Compound Name | 4-amino-3-methoxy-N-[3-(thiomorpholine-4-carbonyl)phenyl]butanamide;hydrochloride |
|---|---|
| PubChem CID | 120590833 |
| Molecular Formula | C16H24ClN3O3S |
| Molecular Weight | 373.91 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | 4-amino-3-methoxy-N-[3-(thiomorpholine-4-carbonyl)phenyl]butanamide;hydrochloride |
| SMILES | COC(CN)CC(=O)Nc1cccc(C(=O)N2CCSCC2)c1.Cl |
| InChI | InChI=1S/C16H23N3O3S.ClH/c1-22-14(11-17)10-15(20)18-13-4-2-3-12(9-13)16(21)19-5-7-23-8-6-19;/h2-4,9,14H,5-8,10-11,17H2,1H3,(H,18,20);1H |
| InChIKey | LRSIBZSZVCYJKR-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.91 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |