C21H33N3O2S — CID 52855772
2-[bis(2-methylpropyl)amino]-N-[3-(thiomorpholine-4-carbonyl)phenyl]acetamide (PubChem CID 52855772) has the molecular formula C21H33N3O2S and a molecular weight of 391.58 g/mol. Its IUPAC name is 2-[bis(2-methylpropyl)amino]-N-[3-(thiomorpholine-4-carbonyl)phenyl]acetamide.
| Compound Name | 2-[bis(2-methylpropyl)amino]-N-[3-(thiomorpholine-4-carbonyl)phenyl]acetamide |
|---|---|
| PubChem CID | 52855772 |
| Molecular Formula | C21H33N3O2S |
| Molecular Weight | 391.58 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | 2-[bis(2-methylpropyl)amino]-N-[3-(thiomorpholine-4-carbonyl)phenyl]acetamide |
| SMILES | CC(C)CN(CC(=O)Nc1cccc(C(=O)N2CCSCC2)c1)CC(C)C |
| InChI | InChI=1S/C21H33N3O2S/c1-16(2)13-23(14-17(3)4)15-20(25)22-19-7-5-6-18(12-19)21(26)24-8-10-27-11-9-24/h5-7,12,16-17H,8-11,13-15H2,1-4H3,(H,22,25) |
| InChIKey | VYKOIKPRULJUBE-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.58 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |