C17H26Cl2N2O2 — CID 120591750
4-amino-N-[2-(3,4-dichlorophenyl)-2-ethylbutyl]-3-methoxybutanamide (PubChem CID 120591750) has the molecular formula C17H26Cl2N2O2 and a molecular weight of 361.31 g/mol. Its IUPAC name is 4-amino-N-[2-(3,4-dichlorophenyl)-2-ethylbutyl]-3-methoxybutanamide.
| Compound Name | 4-amino-N-[2-(3,4-dichlorophenyl)-2-ethylbutyl]-3-methoxybutanamide |
|---|---|
| PubChem CID | 120591750 |
| Molecular Formula | C17H26Cl2N2O2 |
| Molecular Weight | 361.31 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | 4-amino-N-[2-(3,4-dichlorophenyl)-2-ethylbutyl]-3-methoxybutanamide |
| SMILES | CCC(CC)(CNC(=O)CC(CN)OC)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H26Cl2N2O2/c1-4-17(5-2,12-6-7-14(18)15(19)8-12)11-21-16(22)9-13(10-20)23-3/h6-8,13H,4-5,9-11,20H2,1-3H3,(H,21,22) |
| InChIKey | YAOQHMVYYZYFTR-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.31 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |