About (2S)-2-amino-N-[2-(3,4-dichlorophenyl)-2-ethylbutyl]propanamide
(2S)-2-amino-N-[2-(3,4-dichlorophenyl)-2-ethylbutyl]propanamide (PubChem CID 119318819) has the molecular formula C15H22Cl2N2O
and a molecular weight of 317.26 g/mol. Its IUPAC name is (2S)-2-amino-N-[2-(3,4-dichlorophenyl)-2-ethylbutyl]propanamide.
Molecular Properties
| Compound Name | (2S)-2-amino-N-[2-(3,4-dichlorophenyl)-2-ethylbutyl]propanamide |
| PubChem CID | 119318819 |
| Molecular Formula | C15H22Cl2N2O |
| Molecular Weight | 317.26 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | (2S)-2-amino-N-[2-(3,4-dichlorophenyl)-2-ethylbutyl]propanamide |
| SMILES | CCC(CC)(CNC(=O)[C@H](C)N)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H22Cl2N2O/c1-4-15(5-2,9-19-14(20)10(3)18)11-6-7-12(16)13(17)8-11/h6-8,10H,4-5,9,18H2,1-3H3,(H,19,20)/t10-/m0/s1 |
| InChIKey | GBJWDPZYQFGISU-JTQLQIEISA-N |
| XLogP | 3.51 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.26 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-2-amino-N-[2-(3,4-dichlorophenyl)-2-ethylbutyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-N-[2-(3,4-dichlorophenyl)-2-ethylbutyl]propanamide?
The IUPAC name of (2S)-2-amino-N-[2-(3,4-dichlorophenyl)-2-ethylbutyl]propanamide (CID 119318819) is (2S)-2-amino-N-[2-(3,4-dichlorophenyl)-2-ethylbutyl]propanamide.
What is the SMILES notation for (2S)-2-amino-N-[2-(3,4-dichlorophenyl)-2-ethylbutyl]propanamide?
The canonical SMILES for (2S)-2-amino-N-[2-(3,4-dichlorophenyl)-2-ethylbutyl]propanamide is CCC(CC)(CNC(=O)[C@H](C)N)c1ccc(Cl)c(Cl)c1.
What is the InChIKey of (2S)-2-amino-N-[2-(3,4-dichlorophenyl)-2-ethylbutyl]propanamide?
The InChIKey is GBJWDPZYQFGISU-JTQLQIEISA-N. The full InChI is InChI=1S/C15H22Cl2N2O/c1-4-15(5-2,9-19-14(20)10(3)18)11-6-7-12(16)13(17)8-11/h6-8,10H,4-5,9,18H2,1-3H3,(H,19,20)/t10-/m0/s1.
What are the key properties of (2S)-2-amino-N-[2-(3,4-dichlorophenyl)-2-ethylbutyl]propanamide?
(2S)-2-amino-N-[2-(3,4-dichlorophenyl)-2-ethylbutyl]propanamide has a molecular weight of 317.26 g/mol, XLogP of 3.51, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-N-[2-(3,4-dichlorophenyl)-2-ethylbutyl]propanamide is sourced from PubChem (CID 119318819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).