C15H22Cl2N2O — CID 119318819
(2S)-2-amino-N-[2-(3,4-dichlorophenyl)-2-ethylbutyl]propanamide (PubChem CID 119318819) has the molecular formula C15H22Cl2N2O and a molecular weight of 317.26 g/mol. Its IUPAC name is (2S)-2-amino-N-[2-(3,4-dichlorophenyl)-2-ethylbutyl]propanamide.
| Compound Name | (2S)-2-amino-N-[2-(3,4-dichlorophenyl)-2-ethylbutyl]propanamide |
|---|---|
| PubChem CID | 119318819 |
| Molecular Formula | C15H22Cl2N2O |
| Molecular Weight | 317.26 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | (2S)-2-amino-N-[2-(3,4-dichlorophenyl)-2-ethylbutyl]propanamide |
| SMILES | CCC(CC)(CNC(=O)[C@H](C)N)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H22Cl2N2O/c1-4-15(5-2,9-19-14(20)10(3)18)11-6-7-12(16)13(17)8-11/h6-8,10H,4-5,9,18H2,1-3H3,(H,19,20)/t10-/m0/s1 |
| InChIKey | GBJWDPZYQFGISU-JTQLQIEISA-N |
| XLogP | 3.51 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.26 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |