C13H18N6O2 — CID 120591918
4-amino-3-methoxy-N-[[4-(2H-tetrazol-5-yl)phenyl]methyl]butanamide (PubChem CID 120591918) has the molecular formula C13H18N6O2 and a molecular weight of 290.33 g/mol. Its IUPAC name is 4-amino-3-methoxy-N-[[4-(2H-tetrazol-5-yl)phenyl]methyl]butanamide.
| Compound Name | 4-amino-3-methoxy-N-[[4-(2H-tetrazol-5-yl)phenyl]methyl]butanamide |
|---|---|
| PubChem CID | 120591918 |
| Molecular Formula | C13H18N6O2 |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 4-amino-3-methoxy-N-[[4-(2H-tetrazol-5-yl)phenyl]methyl]butanamide |
| SMILES | COC(CN)CC(=O)NCc1ccc(-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C13H18N6O2/c1-21-11(7-14)6-12(20)15-8-9-2-4-10(5-3-9)13-16-18-19-17-13/h2-5,11H,6-8,14H2,1H3,(H,15,20)(H,16,17,18,19) |
| InChIKey | BCGZGWVWKPVJQP-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 118.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |