C17H23N5O2 — CID 99631991
2-(4-methoxycyclohexyl)-N-[[4-(2H-tetrazol-5-yl)phenyl]methyl]acetamide (PubChem CID 99631991) has the molecular formula C17H23N5O2 and a molecular weight of 329.40 g/mol. Its IUPAC name is 2-(4-methoxycyclohexyl)-N-[[4-(2H-tetrazol-5-yl)phenyl]methyl]acetamide.
| Compound Name | 2-(4-methoxycyclohexyl)-N-[[4-(2H-tetrazol-5-yl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 99631991 |
| Molecular Formula | C17H23N5O2 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | 2-(4-methoxycyclohexyl)-N-[[4-(2H-tetrazol-5-yl)phenyl]methyl]acetamide |
| SMILES | COC1CCC(CC(=O)NCc2ccc(-c3nn[nH]n3)cc2)CC1 |
| InChI | InChI=1S/C17H23N5O2/c1-24-15-8-4-12(5-9-15)10-16(23)18-11-13-2-6-14(7-3-13)17-19-21-22-20-17/h2-3,6-7,12,15H,4-5,8-11H2,1H3,(H,18,23)(H,19,20,21,22) |
| InChIKey | OQWKCDPCXFEKNA-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |