C15H20N6O2 — CID 120792568
2-amino-2-(oxan-4-yl)-N-[[4-(2H-tetrazol-5-yl)phenyl]methyl]acetamide (PubChem CID 120792568) has the molecular formula C15H20N6O2 and a molecular weight of 316.37 g/mol. Its IUPAC name is 2-amino-2-(oxan-4-yl)-N-[[4-(2H-tetrazol-5-yl)phenyl]methyl]acetamide.
| Compound Name | 2-amino-2-(oxan-4-yl)-N-[[4-(2H-tetrazol-5-yl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 120792568 |
| Molecular Formula | C15H20N6O2 |
| Molecular Weight | 316.37 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | 2-amino-2-(oxan-4-yl)-N-[[4-(2H-tetrazol-5-yl)phenyl]methyl]acetamide |
| SMILES | NC(C(=O)NCc1ccc(-c2nn[nH]n2)cc1)C1CCOCC1 |
| InChI | InChI=1S/C15H20N6O2/c16-13(11-5-7-23-8-6-11)15(22)17-9-10-1-3-12(4-2-10)14-18-20-21-19-14/h1-4,11,13H,5-9,16H2,(H,17,22)(H,18,19,20,21) |
| InChIKey | HWDWARRHRAQQHZ-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 118.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.37 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |