C16H19N5O — CID 167788668
(2E,4Z)-4-ethyl-N-[[4-(2H-tetrazol-5-yl)phenyl]methyl]hexa-2,4-dienamide (PubChem CID 167788668) has the molecular formula C16H19N5O and a molecular weight of 297.36 g/mol. Its IUPAC name is (2E,4Z)-4-ethyl-N-[[4-(2H-tetrazol-5-yl)phenyl]methyl]hexa-2,4-dienamide.
| Compound Name | (2E,4Z)-4-ethyl-N-[[4-(2H-tetrazol-5-yl)phenyl]methyl]hexa-2,4-dienamide |
|---|---|
| PubChem CID | 167788668 |
| Molecular Formula | C16H19N5O |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | (2E,4Z)-4-ethyl-N-[[4-(2H-tetrazol-5-yl)phenyl]methyl]hexa-2,4-dienamide |
| SMILES | C/C=C(\C=C\C(=O)NCc1ccc(-c2nn[nH]n2)cc1)CC |
| InChI | InChI=1S/C16H19N5O/c1-3-12(4-2)7-10-15(22)17-11-13-5-8-14(9-6-13)16-18-20-21-19-16/h3,5-10H,4,11H2,1-2H3,(H,17,22)(H,18,19,20,21)/b10-7+,12-3- |
| InChIKey | YXBVLWAMJAWLNB-QVSSJFJDSA-N |
| XLogP | 2.40 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|