C17H25N3O4 — CID 120592838
4-amino-3-methoxy-N-[2-methyl-5-(morpholine-4-carbonyl)phenyl]butanamide (PubChem CID 120592838) has the molecular formula C17H25N3O4 and a molecular weight of 335.40 g/mol. Its IUPAC name is 4-amino-3-methoxy-N-[2-methyl-5-(morpholine-4-carbonyl)phenyl]butanamide.
| Compound Name | 4-amino-3-methoxy-N-[2-methyl-5-(morpholine-4-carbonyl)phenyl]butanamide |
|---|---|
| PubChem CID | 120592838 |
| Molecular Formula | C17H25N3O4 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | 4-amino-3-methoxy-N-[2-methyl-5-(morpholine-4-carbonyl)phenyl]butanamide |
| SMILES | COC(CN)CC(=O)Nc1cc(C(=O)N2CCOCC2)ccc1C |
| InChI | InChI=1S/C17H25N3O4/c1-12-3-4-13(17(22)20-5-7-24-8-6-20)9-15(12)19-16(21)10-14(11-18)23-2/h3-4,9,14H,5-8,10-11,18H2,1-2H3,(H,19,21) |
| InChIKey | QXQZVOYBZIYJOX-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |