C17H26BrClN2O2 — CID 120592963
4-amino-N-[[1-(4-bromophenyl)cyclopentyl]methyl]-3-methoxybutanamide;hydrochloride (PubChem CID 120592963) has the molecular formula C17H26BrClN2O2 and a molecular weight of 405.76 g/mol. Its IUPAC name is 4-amino-N-[[1-(4-bromophenyl)cyclopentyl]methyl]-3-methoxybutanamide;hydrochloride.
| Compound Name | 4-amino-N-[[1-(4-bromophenyl)cyclopentyl]methyl]-3-methoxybutanamide;hydrochloride |
|---|---|
| PubChem CID | 120592963 |
| Molecular Formula | C17H26BrClN2O2 |
| Molecular Weight | 405.76 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | 4-amino-N-[[1-(4-bromophenyl)cyclopentyl]methyl]-3-methoxybutanamide;hydrochloride |
| SMILES | COC(CN)CC(=O)NCC1(c2ccc(Br)cc2)CCCC1.Cl |
| InChI | InChI=1S/C17H25BrN2O2.ClH/c1-22-15(11-19)10-16(21)20-12-17(8-2-3-9-17)13-4-6-14(18)7-5-13;/h4-7,15H,2-3,8-12,19H2,1H3,(H,20,21);1H |
| InChIKey | OJAFJRYUCTWJJH-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.76 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |