C15H22BrClN2O2 — CID 120589748
4-amino-N-[1-(4-bromophenyl)cyclobutyl]-3-methoxybutanamide;hydrochloride (PubChem CID 120589748) has the molecular formula C15H22BrClN2O2 and a molecular weight of 377.71 g/mol. Its IUPAC name is 4-amino-N-[1-(4-bromophenyl)cyclobutyl]-3-methoxybutanamide;hydrochloride.
| Compound Name | 4-amino-N-[1-(4-bromophenyl)cyclobutyl]-3-methoxybutanamide;hydrochloride |
|---|---|
| PubChem CID | 120589748 |
| Molecular Formula | C15H22BrClN2O2 |
| Molecular Weight | 377.71 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | 4-amino-N-[1-(4-bromophenyl)cyclobutyl]-3-methoxybutanamide;hydrochloride |
| SMILES | COC(CN)CC(=O)NC1(c2ccc(Br)cc2)CCC1.Cl |
| InChI | InChI=1S/C15H21BrN2O2.ClH/c1-20-13(10-17)9-14(19)18-15(7-2-8-15)11-3-5-12(16)6-4-11;/h3-6,13H,2,7-10,17H2,1H3,(H,18,19);1H |
| InChIKey | HLLHCHGOPLQVRW-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.71 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |