C17H25BrN2O — CID 119740974
7-amino-N-[1-(4-bromophenyl)cyclobutyl]heptanamide (PubChem CID 119740974) has the molecular formula C17H25BrN2O and a molecular weight of 353.30 g/mol. Its IUPAC name is 7-amino-N-[1-(4-bromophenyl)cyclobutyl]heptanamide.
| Compound Name | 7-amino-N-[1-(4-bromophenyl)cyclobutyl]heptanamide |
|---|---|
| PubChem CID | 119740974 |
| Molecular Formula | C17H25BrN2O |
| Molecular Weight | 353.30 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 7-amino-N-[1-(4-bromophenyl)cyclobutyl]heptanamide |
| SMILES | NCCCCCCC(=O)NC1(c2ccc(Br)cc2)CCC1 |
| InChI | InChI=1S/C17H25BrN2O/c18-15-9-7-14(8-10-15)17(11-5-12-17)20-16(21)6-3-1-2-4-13-19/h7-10H,1-6,11-13,19H2,(H,20,21) |
| InChIKey | PFQIRJROHCQZSB-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.30 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|