C19H24ClN3O2 — CID 120593007
3-[2-[(2-amino-2-phenylpropanoyl)amino]ethyl]-N-methylbenzamide;hydrochloride (PubChem CID 120593007) has the molecular formula C19H24ClN3O2 and a molecular weight of 361.87 g/mol. Its IUPAC name is 3-[2-[(2-amino-2-phenylpropanoyl)amino]ethyl]-N-methylbenzamide;hydrochloride.
| Compound Name | 3-[2-[(2-amino-2-phenylpropanoyl)amino]ethyl]-N-methylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 120593007 |
| Molecular Formula | C19H24ClN3O2 |
| Molecular Weight | 361.87 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | 3-[2-[(2-amino-2-phenylpropanoyl)amino]ethyl]-N-methylbenzamide;hydrochloride |
| SMILES | CNC(=O)c1cccc(CCNC(=O)C(C)(N)c2ccccc2)c1.Cl |
| InChI | InChI=1S/C19H23N3O2.ClH/c1-19(20,16-9-4-3-5-10-16)18(24)22-12-11-14-7-6-8-15(13-14)17(23)21-2;/h3-10,13H,11-12,20H2,1-2H3,(H,21,23)(H,22,24);1H |
| InChIKey | USAXVCGZXKKZKE-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.87 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |