C17H29ClN2O2 — CID 120593580
4-amino-N-ethyl-3-methoxy-N-(1-phenylbutan-2-yl)butanamide;hydrochloride (PubChem CID 120593580) has the molecular formula C17H29ClN2O2 and a molecular weight of 328.88 g/mol. Its IUPAC name is 4-amino-N-ethyl-3-methoxy-N-(1-phenylbutan-2-yl)butanamide;hydrochloride.
| Compound Name | 4-amino-N-ethyl-3-methoxy-N-(1-phenylbutan-2-yl)butanamide;hydrochloride |
|---|---|
| PubChem CID | 120593580 |
| Molecular Formula | C17H29ClN2O2 |
| Molecular Weight | 328.88 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | 4-amino-N-ethyl-3-methoxy-N-(1-phenylbutan-2-yl)butanamide;hydrochloride |
| SMILES | CCC(Cc1ccccc1)N(CC)C(=O)CC(CN)OC.Cl |
| InChI | InChI=1S/C17H28N2O2.ClH/c1-4-15(11-14-9-7-6-8-10-14)19(5-2)17(20)12-16(13-18)21-3;/h6-10,15-16H,4-5,11-13,18H2,1-3H3;1H |
| InChIKey | WNZATHIEOFWKJG-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.88 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |