C20H24N2OS — CID 120593719
2-amino-2-phenyl-1-[3-(phenylsulfanylmethyl)pyrrolidin-1-yl]propan-1-one (PubChem CID 120593719) has the molecular formula C20H24N2OS and a molecular weight of 340.49 g/mol. Its IUPAC name is 2-amino-2-phenyl-1-[3-(phenylsulfanylmethyl)pyrrolidin-1-yl]propan-1-one.
| Compound Name | 2-amino-2-phenyl-1-[3-(phenylsulfanylmethyl)pyrrolidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 120593719 |
| Molecular Formula | C20H24N2OS |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 2-amino-2-phenyl-1-[3-(phenylsulfanylmethyl)pyrrolidin-1-yl]propan-1-one |
| SMILES | CC(N)(C(=O)N1CCC(CSc2ccccc2)C1)c1ccccc1 |
| InChI | InChI=1S/C20H24N2OS/c1-20(21,17-8-4-2-5-9-17)19(23)22-13-12-16(14-22)15-24-18-10-6-3-7-11-18/h2-11,16H,12-15,21H2,1H3 |
| InChIKey | BXOIVROAMUQHSH-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |