C16H24N2OS2 — CID 119338532
(2S)-2-amino-4-methylsulfanyl-1-[3-(phenylsulfanylmethyl)pyrrolidin-1-yl]butan-1-one (PubChem CID 119338532) has the molecular formula C16H24N2OS2 and a molecular weight of 324.51 g/mol. Its IUPAC name is (2S)-2-amino-4-methylsulfanyl-1-[3-(phenylsulfanylmethyl)pyrrolidin-1-yl]butan-1-one.
| Compound Name | (2S)-2-amino-4-methylsulfanyl-1-[3-(phenylsulfanylmethyl)pyrrolidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 119338532 |
| Molecular Formula | C16H24N2OS2 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | (2S)-2-amino-4-methylsulfanyl-1-[3-(phenylsulfanylmethyl)pyrrolidin-1-yl]butan-1-one |
| SMILES | CSCC[C@H](N)C(=O)N1CCC(CSc2ccccc2)C1 |
| InChI | InChI=1S/C16H24N2OS2/c1-20-10-8-15(17)16(19)18-9-7-13(11-18)12-21-14-5-3-2-4-6-14/h2-6,13,15H,7-12,17H2,1H3/t13?,15-/m0/s1 |
| InChIKey | LUCVHINPHKRSFM-WUJWULDRSA-N |
| XLogP | 2.71 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |