C20H24N2OS — CID 99849554
(2S)-2-amino-3-phenyl-1-[(3S)-3-(phenylsulfanylmethyl)pyrrolidin-1-yl]propan-1-one (PubChem CID 99849554) has the molecular formula C20H24N2OS and a molecular weight of 340.49 g/mol. Its IUPAC name is (2S)-2-amino-3-phenyl-1-[(3S)-3-(phenylsulfanylmethyl)pyrrolidin-1-yl]propan-1-one.
| Compound Name | (2S)-2-amino-3-phenyl-1-[(3S)-3-(phenylsulfanylmethyl)pyrrolidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 99849554 |
| Molecular Formula | C20H24N2OS |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | (2S)-2-amino-3-phenyl-1-[(3S)-3-(phenylsulfanylmethyl)pyrrolidin-1-yl]propan-1-one |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)N1CC[C@H](CSc2ccccc2)C1 |
| InChI | InChI=1S/C20H24N2OS/c21-19(13-16-7-3-1-4-8-16)20(23)22-12-11-17(14-22)15-24-18-9-5-2-6-10-18/h1-10,17,19H,11-15,21H2/t17-,19-/m0/s1 |
| InChIKey | KLEVRZSIYHMWCN-HKUYNNGSSA-N |
| XLogP | 3.20 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |