C14H18N4O4S2 — CID 120594010
4-amino-3-methoxy-N-[3-(1,3-thiazol-2-ylsulfamoyl)phenyl]butanamide (PubChem CID 120594010) has the molecular formula C14H18N4O4S2 and a molecular weight of 370.46 g/mol. Its IUPAC name is 4-amino-3-methoxy-N-[3-(1,3-thiazol-2-ylsulfamoyl)phenyl]butanamide.
| Compound Name | 4-amino-3-methoxy-N-[3-(1,3-thiazol-2-ylsulfamoyl)phenyl]butanamide |
|---|---|
| PubChem CID | 120594010 |
| Molecular Formula | C14H18N4O4S2 |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | 4-amino-3-methoxy-N-[3-(1,3-thiazol-2-ylsulfamoyl)phenyl]butanamide |
| SMILES | COC(CN)CC(=O)Nc1cccc(S(=O)(=O)Nc2nccs2)c1 |
| InChI | InChI=1S/C14H18N4O4S2/c1-22-11(9-15)8-13(19)17-10-3-2-4-12(7-10)24(20,21)18-14-16-5-6-23-14/h2-7,11H,8-9,15H2,1H3,(H,16,18)(H,17,19) |
| InChIKey | GAERQKXTVSBTCF-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 123.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |