C14H18N4O3S2 — CID 120563834
4-amino-N-[3-(1,3-thiazol-2-ylsulfamoyl)phenyl]pentanamide (PubChem CID 120563834) has the molecular formula C14H18N4O3S2 and a molecular weight of 354.46 g/mol. Its IUPAC name is 4-amino-N-[3-(1,3-thiazol-2-ylsulfamoyl)phenyl]pentanamide.
| Compound Name | 4-amino-N-[3-(1,3-thiazol-2-ylsulfamoyl)phenyl]pentanamide |
|---|---|
| PubChem CID | 120563834 |
| Molecular Formula | C14H18N4O3S2 |
| Molecular Weight | 354.46 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | 4-amino-N-[3-(1,3-thiazol-2-ylsulfamoyl)phenyl]pentanamide |
| SMILES | CC(N)CCC(=O)Nc1cccc(S(=O)(=O)Nc2nccs2)c1 |
| InChI | InChI=1S/C14H18N4O3S2/c1-10(15)5-6-13(19)17-11-3-2-4-12(9-11)23(20,21)18-14-16-7-8-22-14/h2-4,7-10H,5-6,15H2,1H3,(H,16,18)(H,17,19) |
| InChIKey | SVXWGVUAXIYKLZ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.46 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |