C12H14N2O3S2 — CID 71689341
3-(ethoxymethyl)-N-(1,3-thiazol-2-yl)benzenesulfonamide (PubChem CID 71689341) has the molecular formula C12H14N2O3S2 and a molecular weight of 298.39 g/mol. Its IUPAC name is 3-(ethoxymethyl)-N-(1,3-thiazol-2-yl)benzenesulfonamide.
| Compound Name | 3-(ethoxymethyl)-N-(1,3-thiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 71689341 |
| Molecular Formula | C12H14N2O3S2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | 3-(ethoxymethyl)-N-(1,3-thiazol-2-yl)benzenesulfonamide |
| SMILES | CCOCc1cccc(S(=O)(=O)Nc2nccs2)c1 |
| InChI | InChI=1S/C12H14N2O3S2/c1-2-17-9-10-4-3-5-11(8-10)19(15,16)14-12-13-6-7-18-12/h3-8H,2,9H2,1H3,(H,13,14) |
| InChIKey | CLVHOWCQFGFMBX-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |