C16H21Cl2N3O — CID 120594633
2-amino-2-phenyl-N-(1-pyridin-2-ylethyl)propanamide;dihydrochloride (PubChem CID 120594633) has the molecular formula C16H21Cl2N3O and a molecular weight of 342.27 g/mol. Its IUPAC name is 2-amino-2-phenyl-N-(1-pyridin-2-ylethyl)propanamide;dihydrochloride.
| Compound Name | 2-amino-2-phenyl-N-(1-pyridin-2-ylethyl)propanamide;dihydrochloride |
|---|---|
| PubChem CID | 120594633 |
| Molecular Formula | C16H21Cl2N3O |
| Molecular Weight | 342.27 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | 2-amino-2-phenyl-N-(1-pyridin-2-ylethyl)propanamide;dihydrochloride |
| SMILES | CC(NC(=O)C(C)(N)c1ccccc1)c1ccccn1.Cl.Cl |
| InChI | InChI=1S/C16H19N3O.2ClH/c1-12(14-10-6-7-11-18-14)19-15(20)16(2,17)13-8-4-3-5-9-13;;/h3-12H,17H2,1-2H3,(H,19,20);2*1H |
| InChIKey | DVMQQDNAEOXYSC-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.27 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |