C18H22N4O4 — CID 120597201
4-[2-[(4-amino-3-methoxybutanoyl)amino]phenoxy]-N-methylpyridine-2-carboxamide (PubChem CID 120597201) has the molecular formula C18H22N4O4 and a molecular weight of 358.40 g/mol. Its IUPAC name is 4-[2-[(4-amino-3-methoxybutanoyl)amino]phenoxy]-N-methylpyridine-2-carboxamide.
| Compound Name | 4-[2-[(4-amino-3-methoxybutanoyl)amino]phenoxy]-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 120597201 |
| Molecular Formula | C18H22N4O4 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 4-[2-[(4-amino-3-methoxybutanoyl)amino]phenoxy]-N-methylpyridine-2-carboxamide |
| SMILES | CNC(=O)c1cc(Oc2ccccc2NC(=O)CC(CN)OC)ccn1 |
| InChI | InChI=1S/C18H22N4O4/c1-20-18(24)15-9-12(7-8-21-15)26-16-6-4-3-5-14(16)22-17(23)10-13(11-19)25-2/h3-9,13H,10-11,19H2,1-2H3,(H,20,24)(H,22,23) |
| InChIKey | JYTGBYOWEUOZQY-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 115.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |