C12H21ClN2O3 — CID 120597638
4-amino-3-methoxy-N-methyl-N-[(5-methylfuran-2-yl)methyl]butanamide;hydrochloride (PubChem CID 120597638) has the molecular formula C12H21ClN2O3 and a molecular weight of 276.76 g/mol. Its IUPAC name is 4-amino-3-methoxy-N-methyl-N-[(5-methylfuran-2-yl)methyl]butanamide;hydrochloride.
| Compound Name | 4-amino-3-methoxy-N-methyl-N-[(5-methylfuran-2-yl)methyl]butanamide;hydrochloride |
|---|---|
| PubChem CID | 120597638 |
| Molecular Formula | C12H21ClN2O3 |
| Molecular Weight | 276.76 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 4-amino-3-methoxy-N-methyl-N-[(5-methylfuran-2-yl)methyl]butanamide;hydrochloride |
| SMILES | COC(CN)CC(=O)N(C)Cc1ccc(C)o1.Cl |
| InChI | InChI=1S/C12H20N2O3.ClH/c1-9-4-5-10(17-9)8-14(2)12(15)6-11(7-13)16-3;/h4-5,11H,6-8,13H2,1-3H3;1H |
| InChIKey | TWIIOHGWVTWJJJ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 68.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.76 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |