C18H24ClN3O3S2 — CID 120598211
N-(2-methylpiperidin-4-yl)-3-(thiophen-2-ylmethylsulfamoyl)benzamide;hydrochloride (PubChem CID 120598211) has the molecular formula C18H24ClN3O3S2 and a molecular weight of 430.00 g/mol. Its IUPAC name is N-(2-methylpiperidin-4-yl)-3-(thiophen-2-ylmethylsulfamoyl)benzamide;hydrochloride.
| Compound Name | N-(2-methylpiperidin-4-yl)-3-(thiophen-2-ylmethylsulfamoyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 120598211 |
| Molecular Formula | C18H24ClN3O3S2 |
| Molecular Weight | 430.00 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | N-(2-methylpiperidin-4-yl)-3-(thiophen-2-ylmethylsulfamoyl)benzamide;hydrochloride |
| SMILES | CC1CC(NC(=O)c2cccc(S(=O)(=O)NCc3cccs3)c2)CCN1.Cl |
| InChI | InChI=1S/C18H23N3O3S2.ClH/c1-13-10-15(7-8-19-13)21-18(22)14-4-2-6-17(11-14)26(23,24)20-12-16-5-3-9-25-16;/h2-6,9,11,13,15,19-20H,7-8,10,12H2,1H3,(H,21,22);1H |
| InChIKey | AMQYNDLAKCQUBS-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.00 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |