C20H23ClN2OS — CID 120599851
2-(2-chlorophenyl)sulfanyl-N-(2-methylpiperidin-4-yl)-2-phenylacetamide (PubChem CID 120599851) has the molecular formula C20H23ClN2OS and a molecular weight of 374.94 g/mol. Its IUPAC name is 2-(2-chlorophenyl)sulfanyl-N-(2-methylpiperidin-4-yl)-2-phenylacetamide.
| Compound Name | 2-(2-chlorophenyl)sulfanyl-N-(2-methylpiperidin-4-yl)-2-phenylacetamide |
|---|---|
| PubChem CID | 120599851 |
| Molecular Formula | C20H23ClN2OS |
| Molecular Weight | 374.94 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | 2-(2-chlorophenyl)sulfanyl-N-(2-methylpiperidin-4-yl)-2-phenylacetamide |
| SMILES | CC1CC(NC(=O)C(Sc2ccccc2Cl)c2ccccc2)CCN1 |
| InChI | InChI=1S/C20H23ClN2OS/c1-14-13-16(11-12-22-14)23-20(24)19(15-7-3-2-4-8-15)25-18-10-6-5-9-17(18)21/h2-10,14,16,19,22H,11-13H2,1H3,(H,23,24) |
| InChIKey | CFOJDMQDNWODQV-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.94 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |