C18H26N2O3 — CID 120599937
N-(2-methylpiperidin-4-yl)-3-(oxolan-2-ylmethoxy)benzamide (PubChem CID 120599937) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is N-(2-methylpiperidin-4-yl)-3-(oxolan-2-ylmethoxy)benzamide.
| Compound Name | N-(2-methylpiperidin-4-yl)-3-(oxolan-2-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 120599937 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | N-(2-methylpiperidin-4-yl)-3-(oxolan-2-ylmethoxy)benzamide |
| SMILES | CC1CC(NC(=O)c2cccc(OCC3CCCO3)c2)CCN1 |
| InChI | InChI=1S/C18H26N2O3/c1-13-10-15(7-8-19-13)20-18(21)14-4-2-5-16(11-14)23-12-17-6-3-9-22-17/h2,4-5,11,13,15,17,19H,3,6-10,12H2,1H3,(H,20,21) |
| InChIKey | NLMDJQUZKDKPAG-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |