C17H26N2OS — CID 120601282
N-(2-methylpiperidin-4-yl)-1-thiophen-2-ylcyclohexane-1-carboxamide (PubChem CID 120601282) has the molecular formula C17H26N2OS and a molecular weight of 306.47 g/mol. Its IUPAC name is N-(2-methylpiperidin-4-yl)-1-thiophen-2-ylcyclohexane-1-carboxamide.
| Compound Name | N-(2-methylpiperidin-4-yl)-1-thiophen-2-ylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 120601282 |
| Molecular Formula | C17H26N2OS |
| Molecular Weight | 306.47 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | N-(2-methylpiperidin-4-yl)-1-thiophen-2-ylcyclohexane-1-carboxamide |
| SMILES | CC1CC(NC(=O)C2(c3cccs3)CCCCC2)CCN1 |
| InChI | InChI=1S/C17H26N2OS/c1-13-12-14(7-10-18-13)19-16(20)17(8-3-2-4-9-17)15-6-5-11-21-15/h5-6,11,13-14,18H,2-4,7-10,12H2,1H3,(H,19,20) |
| InChIKey | FAXGHTYAVZRPDO-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.47 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |