C16H28O3Si — CID 12060365
methyl (1R,2S,4S)-1-[tert-butyl(dimethyl)silyl]oxybicyclo[2.2.2]oct-5-ene-2-carboxylate (PubChem CID 12060365) has the molecular formula C16H28O3Si and a molecular weight of 296.48 g/mol. Its IUPAC name is methyl (1R,2S,4S)-1-[tert-butyl(dimethyl)silyl]oxybicyclo[2.2.2]oct-5-ene-2-carboxylate.
| Compound Name | methyl (1R,2S,4S)-1-[tert-butyl(dimethyl)silyl]oxybicyclo[2.2.2]oct-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 12060365 |
| Molecular Formula | C16H28O3Si |
| Molecular Weight | 296.48 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | methyl (1R,2S,4S)-1-[tert-butyl(dimethyl)silyl]oxybicyclo[2.2.2]oct-5-ene-2-carboxylate |
| SMILES | COC(=O)[C@H]1C[C@H]2C=C[C@]1(O[Si](C)(C)C(C)(C)C)CC2 |
| InChI | InChI=1S/C16H28O3Si/c1-15(2,3)20(5,6)19-16-9-7-12(8-10-16)11-13(16)14(17)18-4/h7,9,12-13H,8,10-11H2,1-6H3/t12-,13+,16-/m0/s1 |
| InChIKey | OGWDXVPLMFQCIA-ZENOOKHLSA-N |
| XLogP | 3.91 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.48 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|