C13H24O3Si — CID 101202524
methyl 2-(1-trimethylsilyloxycyclohex-2-en-1-yl)propanoate (PubChem CID 101202524) has the molecular formula C13H24O3Si and a molecular weight of 256.42 g/mol. Its IUPAC name is methyl 2-(1-trimethylsilyloxycyclohex-2-en-1-yl)propanoate.
| Compound Name | methyl 2-(1-trimethylsilyloxycyclohex-2-en-1-yl)propanoate |
|---|---|
| PubChem CID | 101202524 |
| Molecular Formula | C13H24O3Si |
| Molecular Weight | 256.42 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | methyl 2-(1-trimethylsilyloxycyclohex-2-en-1-yl)propanoate |
| SMILES | COC(=O)C(C)C1(O[Si](C)(C)C)C=CCCC1 |
| InChI | InChI=1S/C13H24O3Si/c1-11(12(14)15-2)13(16-17(3,4)5)9-7-6-8-10-13/h7,9,11H,6,8,10H2,1-5H3 |
| InChIKey | DOLGAPCFCHOEFE-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.42 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|