C17H26O3Si — CID 23257945
methyl (1S,6R,7S)-7-[(2E)-penta-2,4-dienyl]-1-trimethylsilyloxybicyclo[4.1.0]hept-2-ene-7-carboxylate (PubChem CID 23257945) has the molecular formula C17H26O3Si and a molecular weight of 306.48 g/mol. Its IUPAC name is methyl (1S,6R,7S)-7-[(2E)-penta-2,4-dienyl]-1-trimethylsilyloxybicyclo[4.1.0]hept-2-ene-7-carboxylate.
| Compound Name | methyl (1S,6R,7S)-7-[(2E)-penta-2,4-dienyl]-1-trimethylsilyloxybicyclo[4.1.0]hept-2-ene-7-carboxylate |
|---|---|
| PubChem CID | 23257945 |
| Molecular Formula | C17H26O3Si |
| Molecular Weight | 306.48 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | methyl (1S,6R,7S)-7-[(2E)-penta-2,4-dienyl]-1-trimethylsilyloxybicyclo[4.1.0]hept-2-ene-7-carboxylate |
| SMILES | C=C/C=C/C[C@]1(C(=O)OC)[C@H]2CCC=C[C@]21O[Si](C)(C)C |
| InChI | InChI=1S/C17H26O3Si/c1-6-7-9-12-16(15(18)19-2)14-11-8-10-13-17(14,16)20-21(3,4)5/h6-7,9-10,13-14H,1,8,11-12H2,2-5H3/b9-7+/t14-,16-,17+/m1/s1 |
| InChIKey | JQFXMPNZNQOFCL-VIXQFLQDSA-N |
| XLogP | 3.85 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.48 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|