C17H28O3Si — CID 10638571
cis-methyl (1S,2R)-1-[(2Z,4E)-hexa-2,4-dienyl]-2-[(E)-prop-1-enyl]-2-trimethylsilyloxycyclopropane-1-carboxylate (PubChem CID 10638571) has the molecular formula C17H28O3Si and a molecular weight of 308.49 g/mol. Its IUPAC name is cis-methyl (1S,2R)-1-[(2Z,4E)-hexa-2,4-dienyl]-2-[(E)-prop-1-enyl]-2-trimethylsilyloxycyclopropane-1-carboxylate.
| Compound Name | cis-methyl (1S,2R)-1-[(2Z,4E)-hexa-2,4-dienyl]-2-[(E)-prop-1-enyl]-2-trimethylsilyloxycyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 10638571 |
| Molecular Formula | C17H28O3Si |
| Molecular Weight | 308.49 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | cis-methyl (1S,2R)-1-[(2Z,4E)-hexa-2,4-dienyl]-2-[(E)-prop-1-enyl]-2-trimethylsilyloxycyclopropane-1-carboxylate |
| SMILES | C/C=C/C=C\C[C@]1(C(=O)OC)C[C@]1(/C=C/C)O[Si](C)(C)C |
| InChI | InChI=1S/C17H28O3Si/c1-7-9-10-11-13-16(15(18)19-3)14-17(16,12-8-2)20-21(4,5)6/h7-12H,13-14H2,1-6H3/b9-7+,11-10-,12-8+/t16-,17+/m1/s1 |
| InChIKey | OHKCMUGDHZIAAY-JPAKHAEWSA-N |
| XLogP | 4.24 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.49 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|