C17H19F5O3Si — CID 102102676
methyl 2-(2,3,4,5,6-pentafluorophenyl)-1-prop-2-enyl-2-trimethylsilyloxycyclopropane-1-carboxylate (PubChem CID 102102676) has the molecular formula C17H19F5O3Si and a molecular weight of 394.41 g/mol. Its IUPAC name is methyl 2-(2,3,4,5,6-pentafluorophenyl)-1-prop-2-enyl-2-trimethylsilyloxycyclopropane-1-carboxylate.
| Compound Name | methyl 2-(2,3,4,5,6-pentafluorophenyl)-1-prop-2-enyl-2-trimethylsilyloxycyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 102102676 |
| Molecular Formula | C17H19F5O3Si |
| Molecular Weight | 394.41 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | methyl 2-(2,3,4,5,6-pentafluorophenyl)-1-prop-2-enyl-2-trimethylsilyloxycyclopropane-1-carboxylate |
| SMILES | C=CCC1(C(=O)OC)CC1(O[Si](C)(C)C)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C17H19F5O3Si/c1-6-7-16(15(23)24-2)8-17(16,25-26(3,4)5)9-10(18)12(20)14(22)13(21)11(9)19/h6H,1,7-8H2,2-5H3 |
| InChIKey | RWFABTIOKKDSKG-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.41 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|