C15H28O2Si — CID 135018892
[tert-butyl(dimethyl)silyl] (2S)-2-[(1R)-cyclohex-2-en-1-yl]propanoate (PubChem CID 135018892) has the molecular formula C15H28O2Si and a molecular weight of 268.47 g/mol. Its IUPAC name is [tert-butyl(dimethyl)silyl] (2S)-2-[(1R)-cyclohex-2-en-1-yl]propanoate.
| Compound Name | [tert-butyl(dimethyl)silyl] (2S)-2-[(1R)-cyclohex-2-en-1-yl]propanoate |
|---|---|
| PubChem CID | 135018892 |
| Molecular Formula | C15H28O2Si |
| Molecular Weight | 268.47 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | [tert-butyl(dimethyl)silyl] (2S)-2-[(1R)-cyclohex-2-en-1-yl]propanoate |
| SMILES | C[C@H](C(=O)O[Si](C)(C)C(C)(C)C)[C@H]1C=CCCC1 |
| InChI | InChI=1S/C15H28O2Si/c1-12(13-10-8-7-9-11-13)14(16)17-18(5,6)15(2,3)4/h8,10,12-13H,7,9,11H2,1-6H3/t12-,13-/m0/s1 |
| InChIKey | ZFNFFIRXYOOEBJ-STQMWFEESA-N |
| XLogP | 4.53 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.47 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|