C18H25F3N2O2 — CID 120604549
N-[3-(aminomethyl)-5-(trifluoromethyl)phenyl]-2-cycloheptyloxypropanamide (PubChem CID 120604549) has the molecular formula C18H25F3N2O2 and a molecular weight of 358.40 g/mol. Its IUPAC name is N-[3-(aminomethyl)-5-(trifluoromethyl)phenyl]-2-cycloheptyloxypropanamide.
| Compound Name | N-[3-(aminomethyl)-5-(trifluoromethyl)phenyl]-2-cycloheptyloxypropanamide |
|---|---|
| PubChem CID | 120604549 |
| Molecular Formula | C18H25F3N2O2 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | N-[3-(aminomethyl)-5-(trifluoromethyl)phenyl]-2-cycloheptyloxypropanamide |
| SMILES | CC(OC1CCCCCC1)C(=O)Nc1cc(CN)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H25F3N2O2/c1-12(25-16-6-4-2-3-5-7-16)17(24)23-15-9-13(11-22)8-14(10-15)18(19,20)21/h8-10,12,16H,2-7,11,22H2,1H3,(H,23,24) |
| InChIKey | NQVAKNUJFNIJJJ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |