C12H16ClF3N2OS — CID 120604922
N-[3-(aminomethyl)-5-(trifluoromethyl)phenyl]-2-methylsulfanylpropanamide;hydrochloride (PubChem CID 120604922) has the molecular formula C12H16ClF3N2OS and a molecular weight of 328.79 g/mol. Its IUPAC name is N-[3-(aminomethyl)-5-(trifluoromethyl)phenyl]-2-methylsulfanylpropanamide;hydrochloride.
| Compound Name | N-[3-(aminomethyl)-5-(trifluoromethyl)phenyl]-2-methylsulfanylpropanamide;hydrochloride |
|---|---|
| PubChem CID | 120604922 |
| Molecular Formula | C12H16ClF3N2OS |
| Molecular Weight | 328.79 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | N-[3-(aminomethyl)-5-(trifluoromethyl)phenyl]-2-methylsulfanylpropanamide;hydrochloride |
| SMILES | CSC(C)C(=O)Nc1cc(CN)cc(C(F)(F)F)c1.Cl |
| InChI | InChI=1S/C12H15F3N2OS.ClH/c1-7(19-2)11(18)17-10-4-8(6-16)3-9(5-10)12(13,14)15;/h3-5,7H,6,16H2,1-2H3,(H,17,18);1H |
| InChIKey | UPVPUOSFMLFVDU-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.79 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |