C15H17ClF3N5O3 — CID 120604876
N-[3-(aminomethyl)-5-(trifluoromethyl)phenyl]-4-nitro-5-propyl-1H-pyrazole-3-carboxamide;hydrochloride (PubChem CID 120604876) has the molecular formula C15H17ClF3N5O3 and a molecular weight of 407.78 g/mol. Its IUPAC name is N-[3-(aminomethyl)-5-(trifluoromethyl)phenyl]-4-nitro-5-propyl-1H-pyrazole-3-carboxamide;hydrochloride.
| Compound Name | N-[3-(aminomethyl)-5-(trifluoromethyl)phenyl]-4-nitro-5-propyl-1H-pyrazole-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120604876 |
| Molecular Formula | C15H17ClF3N5O3 |
| Molecular Weight | 407.78 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | N-[3-(aminomethyl)-5-(trifluoromethyl)phenyl]-4-nitro-5-propyl-1H-pyrazole-3-carboxamide;hydrochloride |
| SMILES | CCCc1[nH]nc(C(=O)Nc2cc(CN)cc(C(F)(F)F)c2)c1[N+](=O)[O-].Cl |
| InChI | InChI=1S/C15H16F3N5O3.ClH/c1-2-3-11-13(23(25)26)12(22-21-11)14(24)20-10-5-8(7-19)4-9(6-10)15(16,17)18;/h4-6H,2-3,7,19H2,1H3,(H,20,24)(H,21,22);1H |
| InChIKey | QOHNONBBWXDNQW-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 126.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.78 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|