C14H15ClF3N5O3 — CID 120604706
N-[3-(aminomethyl)-5-(trifluoromethyl)phenyl]-1,3-dimethyl-4-nitropyrazole-5-carboxamide;hydrochloride (PubChem CID 120604706) has the molecular formula C14H15ClF3N5O3 and a molecular weight of 393.75 g/mol. Its IUPAC name is N-[3-(aminomethyl)-5-(trifluoromethyl)phenyl]-1,3-dimethyl-4-nitropyrazole-5-carboxamide;hydrochloride.
| Compound Name | N-[3-(aminomethyl)-5-(trifluoromethyl)phenyl]-1,3-dimethyl-4-nitropyrazole-5-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120604706 |
| Molecular Formula | C14H15ClF3N5O3 |
| Molecular Weight | 393.75 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | N-[3-(aminomethyl)-5-(trifluoromethyl)phenyl]-1,3-dimethyl-4-nitropyrazole-5-carboxamide;hydrochloride |
| SMILES | Cc1nn(C)c(C(=O)Nc2cc(CN)cc(C(F)(F)F)c2)c1[N+](=O)[O-].Cl |
| InChI | InChI=1S/C14H14F3N5O3.ClH/c1-7-11(22(24)25)12(21(2)20-7)13(23)19-10-4-8(6-18)3-9(5-10)14(15,16)17;/h3-5H,6,18H2,1-2H3,(H,19,23);1H |
| InChIKey | TYRCSEKHMJUWKF-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 116.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.75 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|