C13H11F3N4O4 — CID 75394457
N-[4-hydroxy-3-(trifluoromethyl)phenyl]-1,3-dimethyl-4-nitropyrazole-5-carboxamide (PubChem CID 75394457) has the molecular formula C13H11F3N4O4 and a molecular weight of 344.25 g/mol. Its IUPAC name is N-[4-hydroxy-3-(trifluoromethyl)phenyl]-1,3-dimethyl-4-nitropyrazole-5-carboxamide.
| Compound Name | N-[4-hydroxy-3-(trifluoromethyl)phenyl]-1,3-dimethyl-4-nitropyrazole-5-carboxamide |
|---|---|
| PubChem CID | 75394457 |
| Molecular Formula | C13H11F3N4O4 |
| Molecular Weight | 344.25 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | N-[4-hydroxy-3-(trifluoromethyl)phenyl]-1,3-dimethyl-4-nitropyrazole-5-carboxamide |
| SMILES | Cc1nn(C)c(C(=O)Nc2ccc(O)c(C(F)(F)F)c2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H11F3N4O4/c1-6-10(20(23)24)11(19(2)18-6)12(22)17-7-3-4-9(21)8(5-7)13(14,15)16/h3-5,21H,1-2H3,(H,17,22) |
| InChIKey | FSJNXIREABVGMU-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 110.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.25 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|