C11H8F3N3O2 — CID 143860074
N-[4-hydroxy-3-(trifluoromethyl)phenyl]imidazole-1-carboxamide (PubChem CID 143860074) has the molecular formula C11H8F3N3O2 and a molecular weight of 271.20 g/mol. Its IUPAC name is N-[4-hydroxy-3-(trifluoromethyl)phenyl]imidazole-1-carboxamide.
| Compound Name | N-[4-hydroxy-3-(trifluoromethyl)phenyl]imidazole-1-carboxamide |
|---|---|
| PubChem CID | 143860074 |
| Molecular Formula | C11H8F3N3O2 |
| Molecular Weight | 271.20 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | N-[4-hydroxy-3-(trifluoromethyl)phenyl]imidazole-1-carboxamide |
| SMILES | O=C(Nc1ccc(O)c(C(F)(F)F)c1)n1ccnc1 |
| InChI | InChI=1S/C11H8F3N3O2/c12-11(13,14)8-5-7(1-2-9(8)18)16-10(19)17-4-3-15-6-17/h1-6,18H,(H,16,19) |
| InChIKey | YCNGOSODRVLCPV-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.20 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|