C23H15Cl2F6N5O2 — CID 160740610
1-chloro-4-isocyanato-2-(trifluoromethyl)benzene;N-[4-chloro-3-(trifluoromethyl)phenyl]imidazole-1-carboxamide;3H-pyrrole (PubChem CID 160740610) has the molecular formula C23H15Cl2F6N5O2 and a molecular weight of 578.30 g/mol. Its IUPAC name is 1-chloro-4-isocyanato-2-(trifluoromethyl)benzene;N-[4-chloro-3-(trifluoromethyl)phenyl]imidazole-1-carboxamide;3H-pyrrole.
| Compound Name | 1-chloro-4-isocyanato-2-(trifluoromethyl)benzene;N-[4-chloro-3-(trifluoromethyl)phenyl]imidazole-1-carboxamide;3H-pyrrole |
|---|---|
| PubChem CID | 160740610 |
| Molecular Formula | C23H15Cl2F6N5O2 |
| Molecular Weight | 578.30 g/mol |
| Exact Mass | 577.05 |
| IUPAC Name | 1-chloro-4-isocyanato-2-(trifluoromethyl)benzene;N-[4-chloro-3-(trifluoromethyl)phenyl]imidazole-1-carboxamide;3H-pyrrole |
| SMILES | C1=CN=CC1.O=C(Nc1ccc(Cl)c(C(F)(F)F)c1)n1ccnc1.O=C=Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H7ClF3N3O.C8H3ClF3NO.C4H5N/c12-9-2-1-7(5-8(9)11(13,14)15)17-10(19)18-4-3-16-6-18;9-7-2-1-5(13-4-14)3-6(7)8(10,11)12;1-2-4-5-3-1/h1-6H,(H,17,19);1-3H;1,3-4H,2H2 |
| InChIKey | RVNJWCCRZDRVPA-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 88.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.30 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|