C18H18F3N3O4 — CID 120605441
N-[3-(aminomethyl)-5-(trifluoromethyl)phenyl]-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl)acetamide (PubChem CID 120605441) has the molecular formula C18H18F3N3O4 and a molecular weight of 397.35 g/mol. Its IUPAC name is N-[3-(aminomethyl)-5-(trifluoromethyl)phenyl]-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl)acetamide.
| Compound Name | N-[3-(aminomethyl)-5-(trifluoromethyl)phenyl]-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl)acetamide |
|---|---|
| PubChem CID | 120605441 |
| Molecular Formula | C18H18F3N3O4 |
| Molecular Weight | 397.35 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | N-[3-(aminomethyl)-5-(trifluoromethyl)phenyl]-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl)acetamide |
| SMILES | NCc1cc(NC(=O)CN2C(=O)C3C4CCC(O4)C3C2=O)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H18F3N3O4/c19-18(20,21)9-3-8(6-22)4-10(5-9)23-13(25)7-24-16(26)14-11-1-2-12(28-11)15(14)17(24)27/h3-5,11-12,14-15H,1-2,6-7,22H2,(H,23,25) |
| InChIKey | JHHNSMNWQDETGN-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.35 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|