C16H20ClIN4O2 — CID 120605979
1-(3-chloro-4-methoxyphenyl)-2-[(1-ethyl-2-oxo-3-pyridinyl)methyl]guanidine;hydroiodide (PubChem CID 120605979) has the molecular formula C16H20ClIN4O2 and a molecular weight of 462.72 g/mol. Its IUPAC name is 1-(3-chloro-4-methoxyphenyl)-2-[(1-ethyl-2-oxo-3-pyridinyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(3-chloro-4-methoxyphenyl)-2-[(1-ethyl-2-oxo-3-pyridinyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 120605979 |
| Molecular Formula | C16H20ClIN4O2 |
| Molecular Weight | 462.72 g/mol |
| Exact Mass | 462.03 |
| IUPAC Name | 1-(3-chloro-4-methoxyphenyl)-2-[(1-ethyl-2-oxo-3-pyridinyl)methyl]guanidine;hydroiodide |
| SMILES | CCn1cccc(C/N=C(\N)Nc2ccc(OC)c(Cl)c2)c1=O.I |
| InChI | InChI=1S/C16H19ClN4O2.HI/c1-3-21-8-4-5-11(15(21)22)10-19-16(18)20-12-6-7-14(23-2)13(17)9-12;/h4-9H,3,10H2,1-2H3,(H3,18,19,20);1H |
| InChIKey | SESLOEHLGUUDIS-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 81.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.72 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|